About 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile
5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile (PubChem CID 100763144) has the molecular formula C17H22N4O
and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile |
| PubChem CID | 100763144 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile |
| SMILES | Cc1ccc(COc2nn(CC(C)C)c(N)c2C#N)cc1C |
| InChI | InChI=1S/C17H22N4O/c1-11(2)9-21-16(19)15(8-18)17(20-21)22-10-14-6-5-12(3)13(4)7-14/h5-7,11H,9-10,19H2,1-4H3 |
| InChIKey | LDPUJVMLFBOSRH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile?
The IUPAC name of 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile (CID 100763144) is 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile.
What is the SMILES notation for 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile?
The canonical SMILES for 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile is Cc1ccc(COc2nn(CC(C)C)c(N)c2C#N)cc1C.
What is the InChIKey of 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile?
The InChIKey is LDPUJVMLFBOSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O/c1-11(2)9-21-16(19)15(8-18)17(20-21)22-10-14-6-5-12(3)13(4)7-14/h5-7,11H,9-10,19H2,1-4H3.
What are the key properties of 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile?
5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile has a molecular weight of 298.39 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-[(3,4-dimethylphenyl)methoxy]-1-(2-methylpropyl)pyrazole-4-carbonitrile is sourced from PubChem (CID 100763144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).