C20H20IN3O2 — CID 100763929
N-(2-ethyl-6-methylphenyl)-3-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 100763929) has the molecular formula C20H20IN3O2 and a molecular weight of 461.30 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-3-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-3-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 100763929 |
| Molecular Formula | C20H20IN3O2 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-3-[3-(4-iodophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCc1cccc(C)c1NC(=O)CCc1nc(-c2ccc(I)cc2)no1 |
| InChI | InChI=1S/C20H20IN3O2/c1-3-14-6-4-5-13(2)19(14)22-17(25)11-12-18-23-20(24-26-18)15-7-9-16(21)10-8-15/h4-10H,3,11-12H2,1-2H3,(H,22,25) |
| InChIKey | OAFVZVFHTWAHJF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|