C33H42N4O4 — CID 10076457
N-[2-[(2-amino-2-oxoethyl)-[2-(4-hydroxyphenyl)ethyl]amino]-2-oxoethyl]-2-(2,2-diphenylethylamino)-N-pentylacetamide (PubChem CID 10076457) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is N-[2-[(2-amino-2-oxoethyl)-[2-(4-hydroxyphenyl)ethyl]amino]-2-oxoethyl]-2-(2,2-diphenylethylamino)-N-pentylacetamide.
| Compound Name | N-[2-[(2-amino-2-oxoethyl)-[2-(4-hydroxyphenyl)ethyl]amino]-2-oxoethyl]-2-(2,2-diphenylethylamino)-N-pentylacetamide |
|---|---|
| PubChem CID | 10076457 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | N-[2-[(2-amino-2-oxoethyl)-[2-(4-hydroxyphenyl)ethyl]amino]-2-oxoethyl]-2-(2,2-diphenylethylamino)-N-pentylacetamide |
| SMILES | CCCCCN(CC(=O)N(CCc1ccc(O)cc1)CC(N)=O)C(=O)CNCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H42N4O4/c1-2-3-10-20-36(25-33(41)37(24-31(34)39)21-19-26-15-17-29(38)18-16-26)32(40)23-35-22-30(27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-18,30,35,38H,2-3,10,19-25H2,1H3,(H2,34,39) |
| InChIKey | PNHGSFHOUGAQKP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|