About CID 10076536
CID 10076536 (PubChem CID 10076536) has the molecular formula C24H27Cl3N2O7
and a molecular weight of 561.85 g/mol.
Molecular Properties
| Compound Name | CID 10076536 |
| PubChem CID | 10076536 |
| Molecular Formula | C24H27Cl3N2O7 |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | — |
| SMILES | COC1OC(C)C2(CN(C(=O)OCC(Cl)(Cl)Cl)C3CC4(C(=O)Nc5ccccc54)C4CC2C3CO4)O1 |
| InChI | InChI=1S/C24H27Cl3N2O7/c1-12-23(36-21(32-2)35-12)10-29(20(31)34-11-24(25,26)27)17-8-22(18-7-15(23)13(17)9-33-18)14-5-3-4-6-16(14)28-19(22)30/h3-6,12-13,15,17-18,21H,7-11H2,1-2H3,(H,28,30) |
| InChIKey | ZNESMIJYSIXJFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 10076536 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10076536?
The IUPAC name of CID 10076536 (CID 10076536) is not available.
What is the SMILES notation for CID 10076536?
The canonical SMILES for CID 10076536 is COC1OC(C)C2(CN(C(=O)OCC(Cl)(Cl)Cl)C3CC4(C(=O)Nc5ccccc54)C4CC2C3CO4)O1.
What is the InChIKey of CID 10076536?
The InChIKey is ZNESMIJYSIXJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27Cl3N2O7/c1-12-23(36-21(32-2)35-12)10-29(20(31)34-11-24(25,26)27)17-8-22(18-7-15(23)13(17)9-33-18)14-5-3-4-6-16(14)28-19(22)30/h3-6,12-13,15,17-18,21H,7-11H2,1-2H3,(H,28,30).
What are the key properties of CID 10076536?
CID 10076536 has a molecular weight of 561.85 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10076536 is sourced from PubChem (CID 10076536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).