C17H28ClN3O3 — CID 100767537
1-(6-chloro-5-methyl-3-pyridinyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea (PubChem CID 100767537) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-3-pyridinyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea.
| Compound Name | 1-(6-chloro-5-methyl-3-pyridinyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
|---|---|
| PubChem CID | 100767537 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(6-chloro-5-methyl-3-pyridinyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
| SMILES | COC(CCCC(C)(C)CNC(=O)Nc1cnc(Cl)c(C)c1)OC |
| InChI | InChI=1S/C17H28ClN3O3/c1-12-9-13(10-19-15(12)18)21-16(22)20-11-17(2,3)8-6-7-14(23-4)24-5/h9-10,14H,6-8,11H2,1-5H3,(H2,20,21,22) |
| InChIKey | JHSMUHGAZWMNJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|