C22H33NO5 — CID 100768405
methyl 5-[(4-methyl-1-propoxycyclohexanecarbonyl)amino]-2-propan-2-yloxybenzoate (PubChem CID 100768405) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is methyl 5-[(4-methyl-1-propoxycyclohexanecarbonyl)amino]-2-propan-2-yloxybenzoate.
| Compound Name | methyl 5-[(4-methyl-1-propoxycyclohexanecarbonyl)amino]-2-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 100768405 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | methyl 5-[(4-methyl-1-propoxycyclohexanecarbonyl)amino]-2-propan-2-yloxybenzoate |
| SMILES | CCCOC1(C(=O)Nc2ccc(OC(C)C)c(C(=O)OC)c2)CCC(C)CC1 |
| InChI | InChI=1S/C22H33NO5/c1-6-13-27-22(11-9-16(4)10-12-22)21(25)23-17-7-8-19(28-15(2)3)18(14-17)20(24)26-5/h7-8,14-16H,6,9-13H2,1-5H3,(H,23,25) |
| InChIKey | GDDALBHXGPBILC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |