C24H30N3O+ — CID 10076856
4,5-diethyl-14-methoxy-17-pentyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 10076856) has the molecular formula C24H30N3O+ and a molecular weight of 376.52 g/mol. Its IUPAC name is 4,5-diethyl-14-methoxy-17-pentyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 4,5-diethyl-14-methoxy-17-pentyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 10076856 |
| Molecular Formula | C24H30N3O+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4,5-diethyl-14-methoxy-17-pentyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | CCCCCn1c2cc(OC)ccc2c2cc[n+]3nc(CC)c(CC)cc3c21 |
| InChI | InChI=1S/C24H30N3O/c1-5-8-9-13-26-22-16-18(28-4)10-11-19(22)20-12-14-27-23(24(20)26)15-17(6-2)21(7-3)25-27/h10-12,14-16H,5-9,13H2,1-4H3/q+1 |
| InChIKey | OWLKHNMSEJYANE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|