C14H16O7 — CID 10076899
4-ethyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyran-1,3-dione (PubChem CID 10076899) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-ethyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyran-1,3-dione.
| Compound Name | 4-ethyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyran-1,3-dione |
|---|---|
| PubChem CID | 10076899 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-ethyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-4,6,7,7a-tetrahydro-3aH-furo[3,4-c]pyran-1,3-dione |
| SMILES | CCC1OC(C2C(=O)OC(=O)C2C)CC2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C14H16O7/c1-3-7-10-6(12(16)21-14(10)18)4-8(19-7)9-5(2)11(15)20-13(9)17/h5-10H,3-4H2,1-2H3 |
| InChIKey | SBWKBGYKQVMJQI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|