About 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile
4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile (PubChem CID 100770956) has the molecular formula C16H26N4
and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile |
| PubChem CID | 100770956 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile |
| SMILES | CC(C)Cn1c(C#N)cc(N)c1N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C16H26N4/c1-11(2)8-20-14(7-17)6-15(18)16(20)19-9-12(3)5-13(4)10-19/h6,11-13H,5,8-10,18H2,1-4H3/t12-,13+ |
| InChIKey | GBDNKYKWIQKBRL-BETUJISGSA-N |
| XLogP | 3.08 |
| TPSA | 57.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile?
The IUPAC name of 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile (CID 100770956) is 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile.
What is the SMILES notation for 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile?
The canonical SMILES for 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile is CC(C)Cn1c(C#N)cc(N)c1N1C[C@H](C)C[C@H](C)C1.
What is the InChIKey of 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile?
The InChIKey is GBDNKYKWIQKBRL-BETUJISGSA-N. The full InChI is InChI=1S/C16H26N4/c1-11(2)8-20-14(7-17)6-15(18)16(20)19-9-12(3)5-13(4)10-19/h6,11-13H,5,8-10,18H2,1-4H3/t12-,13+.
What are the key properties of 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile?
4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile has a molecular weight of 274.41 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-(2-methylpropyl)pyrrole-2-carbonitrile is sourced from PubChem (CID 100770956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).