C27H26ClF6N3O3 — CID 10077113
N-[(E)-1-(4-chlorophenyl)-5-oxo-5-[(2-oxoazepan-3-yl)amino]pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 10077113) has the molecular formula C27H26ClF6N3O3 and a molecular weight of 589.96 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)-5-oxo-5-[(2-oxoazepan-3-yl)amino]pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)-5-oxo-5-[(2-oxoazepan-3-yl)amino]pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10077113 |
| Molecular Formula | C27H26ClF6N3O3 |
| Molecular Weight | 589.96 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)-5-oxo-5-[(2-oxoazepan-3-yl)amino]pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(/C=C/C(=O)NC1CCCCNC1=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClF6N3O3/c1-37(25(40)17-13-18(26(29,30)31)15-19(14-17)27(32,33)34)21(12-16-5-7-20(28)8-6-16)9-10-23(38)36-22-4-2-3-11-35-24(22)39/h5-10,13-15,21-22H,2-4,11-12H2,1H3,(H,35,39)(H,36,38)/b10-9+ |
| InChIKey | ATMHFQDWDFHUDF-MDZDMXLPSA-N |
| XLogP | 5.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|