About 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile
4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile (PubChem CID 100771190) has the molecular formula C15H24N4O
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile |
| PubChem CID | 100771190 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile |
| SMILES | COCCn1c(C#N)cc(N)c1N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C15H24N4O/c1-11-6-12(2)10-18(9-11)15-14(17)7-13(8-16)19(15)4-5-20-3/h7,11-12H,4-6,9-10,17H2,1-3H3/t11-,12+ |
| InChIKey | SWJJNXDGBGHRTG-TXEJJXNPSA-N |
| XLogP | 2.07 |
| TPSA | 67.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile?
The IUPAC name of 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile (CID 100771190) is 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile.
What is the SMILES notation for 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile?
The canonical SMILES for 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile is COCCn1c(C#N)cc(N)c1N1C[C@H](C)C[C@H](C)C1.
What is the InChIKey of 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile?
The InChIKey is SWJJNXDGBGHRTG-TXEJJXNPSA-N. The full InChI is InChI=1S/C15H24N4O/c1-11-6-12(2)10-18(9-11)15-14(17)7-13(8-16)19(15)4-5-20-3/h7,11-12H,4-6,9-10,17H2,1-3H3/t11-,12+.
What are the key properties of 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile?
4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile has a molecular weight of 276.38 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-1-(2-methoxyethyl)pyrrole-2-carbonitrile is sourced from PubChem (CID 100771190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).