C23H29ClN2O3 — CID 100771359
1-(4-chlorophenyl)-N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]cyclohexane-1-carboxamide (PubChem CID 100771359) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100771359 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[6-(2-ethoxyethoxy)-5-methyl-3-pyridinyl]cyclohexane-1-carboxamide |
| SMILES | CCOCCOc1ncc(NC(=O)C2(c3ccc(Cl)cc3)CCCCC2)cc1C |
| InChI | InChI=1S/C23H29ClN2O3/c1-3-28-13-14-29-21-17(2)15-20(16-25-21)26-22(27)23(11-5-4-6-12-23)18-7-9-19(24)10-8-18/h7-10,15-16H,3-6,11-14H2,1-2H3,(H,26,27) |
| InChIKey | JYKXOVIRLJWNQX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|