C28H34F6O7 — CID 10077244
[(1S,2R,5S,7R,9R,10S,12S,14R,15S,19S)-19-ethyl-14-methyl-13,21-dioxo-7-(2,2,2-trifluoroacetyl)oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-en-15-yl] 2,2,2-trifluoroacetate (PubChem CID 10077244) has the molecular formula C28H34F6O7 and a molecular weight of 596.56 g/mol. Its IUPAC name is [(1S,2R,5S,7R,9R,10S,12S,14R,15S,19S)-19-ethyl-14-methyl-13,21-dioxo-7-(2,2,2-trifluoroacetyl)oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-en-15-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,5S,7R,9R,10S,12S,14R,15S,19S)-19-ethyl-14-methyl-13,21-dioxo-7-(2,2,2-trifluoroacetyl)oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-en-15-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10077244 |
| Molecular Formula | C28H34F6O7 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [(1S,2R,5S,7R,9R,10S,12S,14R,15S,19S)-19-ethyl-14-methyl-13,21-dioxo-7-(2,2,2-trifluoroacetyl)oxy-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-en-15-yl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@H]1CCC[C@H](OC(=O)C(F)(F)F)[C@@H](C)C(=O)[C@H]2C[C@@H]3[C@@H](C=C[C@@H]4C[C@@H](OC(=O)C(F)(F)F)C[C@@H]34)[C@@H]2CC(=O)O1 |
| InChI | InChI=1S/C28H34F6O7/c1-3-15-5-4-6-22(41-26(38)28(32,33)34)13(2)24(36)21-11-19-17(20(21)12-23(35)39-15)8-7-14-9-16(10-18(14)19)40-25(37)27(29,30)31/h7-8,13-22H,3-6,9-12H2,1-2H3/t13-,14-,15+,16-,17-,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | LOJQPRKVXBQVQU-SRKDTECDSA-N |
| XLogP | 5.50 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|