C34H28O6S2 — CID 10077253
3-[[4-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(4-methoxyphenyl)sulfanylchromen-2-one (PubChem CID 10077253) has the molecular formula C34H28O6S2 and a molecular weight of 596.73 g/mol. Its IUPAC name is 3-[[4-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(4-methoxyphenyl)sulfanylchromen-2-one.
| Compound Name | 3-[[4-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(4-methoxyphenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 10077253 |
| Molecular Formula | C34H28O6S2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 3-[[4-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(4-methoxyphenyl)sulfanylchromen-2-one |
| SMILES | C=C/C=C(\C=C/COC)Sc1c(Cc2c(Sc3ccc(OC)cc3)c3ccccc3oc2=O)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C34H28O6S2/c1-4-10-23(11-9-20-37-2)41-31-25-12-5-7-14-29(25)39-33(35)27(31)21-28-32(42-24-18-16-22(38-3)17-19-24)26-13-6-8-15-30(26)40-34(28)36/h4-19H,1,20-21H2,2-3H3/b11-9-,23-10+ |
| InChIKey | KMYZZNINKDKYOC-UPMXICBXSA-N |
| XLogP | 8.01 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|