C23H29Br2N5O4 — CID 10077287
15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-5-hydroxy-1,15-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-8,14,16-trione;dihydrobromide (PubChem CID 10077287) has the molecular formula C23H29Br2N5O4 and a molecular weight of 599.32 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-5-hydroxy-1,15-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-8,14,16-trione;dihydrobromide.
| Compound Name | 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-5-hydroxy-1,15-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-8,14,16-trione;dihydrobromide |
|---|---|
| PubChem CID | 10077287 |
| Molecular Formula | C23H29Br2N5O4 |
| Molecular Weight | 599.32 g/mol |
| Exact Mass | 597.06 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-10-[2-(dimethylamino)ethylamino]-5-hydroxy-1,15-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-8,14,16-trione;dihydrobromide |
| SMILES | Br.Br.CN(C)CCNc1ccc2c(=O)n(CCN(C)C)c(=O)n3c4ccc(O)cc4c(=O)c1c23 |
| InChI | InChI=1S/C23H27N5O4.2BrH/c1-25(2)10-9-24-17-7-6-15-20-19(17)21(30)16-13-14(29)5-8-18(16)28(20)23(32)27(22(15)31)12-11-26(3)4;;/h5-8,13,24,29H,9-12H2,1-4H3;2*1H |
| InChIKey | XMHSUGMANMQOGD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|