C33H48O8Si — CID 10077320
methyl (1R,4S,5R,8S,9R,11S,13S,14S)-5-[tert-butyl(dimethyl)silyl]oxy-8-[2-(2,2-dimethylpropanoyloxy)ethyl]-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate (PubChem CID 10077320) has the molecular formula C33H48O8Si and a molecular weight of 600.83 g/mol. Its IUPAC name is methyl (1R,4S,5R,8S,9R,11S,13S,14S)-5-[tert-butyl(dimethyl)silyl]oxy-8-[2-(2,2-dimethylpropanoyloxy)ethyl]-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate.
| Compound Name | methyl (1R,4S,5R,8S,9R,11S,13S,14S)-5-[tert-butyl(dimethyl)silyl]oxy-8-[2-(2,2-dimethylpropanoyloxy)ethyl]-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate |
|---|---|
| PubChem CID | 10077320 |
| Molecular Formula | C33H48O8Si |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | methyl (1R,4S,5R,8S,9R,11S,13S,14S)-5-[tert-butyl(dimethyl)silyl]oxy-8-[2-(2,2-dimethylpropanoyloxy)ethyl]-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)C=C[C@](CCOC(=O)C(C)(C)C)([C@H]4C[C@@H]1O[C@@H](c1ccccc1)O4)[C@H]32 |
| InChI | InChI=1S/C33H48O8Si/c1-30(2,3)28(34)37-18-17-32-16-15-22(41-42(8,9)31(4,5)6)25-26(32)33(20-38-25,29(35)36-7)24-19-23(32)39-27(40-24)21-13-11-10-12-14-21/h10-16,22-27H,17-20H2,1-9H3/t22-,23-,24+,25-,26+,27+,32+,33-/m1/s1 |
| InChIKey | DVCLQNSHJZYNIF-FYONGLQYSA-N |
| XLogP | 5.97 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|