About N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide
N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide (PubChem CID 100773575) has the molecular formula C14H16FN3O3S2
and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide |
| PubChem CID | 100773575 |
| Molecular Formula | C14H16FN3O3S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N(C)S(C)(=O)=O)sc1C(=O)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN3O3S2/c1-9-12(22-14(16-9)18(3)23(4,20)21)13(19)17(2)11-7-5-10(15)6-8-11/h5-8H,1-4H3 |
| InChIKey | SOXSHTCBMBTZOE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide (CID 100773575) is N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide is Cc1nc(N(C)S(C)(=O)=O)sc1C(=O)N(C)c1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide?
The InChIKey is SOXSHTCBMBTZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3O3S2/c1-9-12(22-14(16-9)18(3)23(4,20)21)13(19)17(2)11-7-5-10(15)6-8-11/h5-8H,1-4H3.
What are the key properties of N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide?
N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide has a molecular weight of 357.43 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N,4-dimethyl-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 100773575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).