C11H9F3N6S2 — CID 100773724
1-methyl-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100773724) has the molecular formula C11H9F3N6S2 and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-methyl-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-methyl-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100773724 |
| Molecular Formula | C11H9F3N6S2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-methyl-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | CNC(=S)Nc1nc(Sc2ncccn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F3N6S2/c1-15-9(21)20-8-18-6(11(12,13)14)5-7(19-8)22-10-16-3-2-4-17-10/h2-5H,1H3,(H2,15,18,19,20,21) |
| InChIKey | DBQMGIHXAWCUAU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|