C38H53NO3S — CID 10077378
N-butyl-11-[1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethyl]sulfanyl-N-methylundecanamide (PubChem CID 10077378) has the molecular formula C38H53NO3S and a molecular weight of 603.91 g/mol. Its IUPAC name is N-butyl-11-[1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethyl]sulfanyl-N-methylundecanamide.
| Compound Name | N-butyl-11-[1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethyl]sulfanyl-N-methylundecanamide |
|---|---|
| PubChem CID | 10077378 |
| Molecular Formula | C38H53NO3S |
| Molecular Weight | 603.91 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | N-butyl-11-[1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethyl]sulfanyl-N-methylundecanamide |
| SMILES | CCCCN(C)C(=O)CCCCCCCCCCSC(Cc1ccc(OCc2ccccc2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C38H53NO3S/c1-4-5-28-39(2)38(40)19-15-10-8-6-7-9-11-16-29-43-37(34-22-26-35(41-3)27-23-34)30-32-20-24-36(25-21-32)42-31-33-17-13-12-14-18-33/h12-14,17-18,20-27,37H,4-11,15-16,19,28-31H2,1-3H3 |
| InChIKey | PZADLNNRBCEQQK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.91 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|