C28H30O11S2 — CID 10077417
[(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] benzoate (PubChem CID 10077417) has the molecular formula C28H30O11S2 and a molecular weight of 606.67 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 10077417 |
| Molecular Formula | C28H30O11S2 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30O11S2/c1-18-9-13-21(14-10-18)40(31,32)36-17-23-24(29)25(38-27(30)20-7-5-4-6-8-20)26(28(35-3)37-23)39-41(33,34)22-15-11-19(2)12-16-22/h4-16,23-26,28-29H,17H2,1-3H3/t23-,24-,25+,26-,28+/m1/s1 |
| InChIKey | CAKPMKQTKJLPKR-CBNWRBMVSA-N |
| XLogP | 2.74 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|