About 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid
2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid (PubChem CID 10077494) has the molecular formula C33H24O12
and a molecular weight of 612.54 g/mol. Its IUPAC name is 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid |
| PubChem CID | 10077494 |
| Molecular Formula | C33H24O12 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1ccc(OCc2cc(COc3ccc(C(=O)C(=O)O)cc3)cc(COc3ccc(C(=O)C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C33H24O12/c34-28(31(37)38)22-1-7-25(8-2-22)43-16-19-13-20(17-44-26-9-3-23(4-10-26)29(35)32(39)40)15-21(14-19)18-45-27-11-5-24(6-12-27)30(36)33(41)42/h1-15H,16-18H2,(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | UCLLOWUBRGAMCO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid?
The IUPAC name of 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid (CID 10077494) is 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid.
What is the SMILES notation for 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid?
The canonical SMILES for 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid is O=C(O)C(=O)c1ccc(OCc2cc(COc3ccc(C(=O)C(=O)O)cc3)cc(COc3ccc(C(=O)C(=O)O)cc3)c2)cc1.
What is the InChIKey of 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid?
The InChIKey is UCLLOWUBRGAMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24O12/c34-28(31(37)38)22-1-7-25(8-2-22)43-16-19-13-20(17-44-26-9-3-23(4-10-26)29(35)32(39)40)15-21(14-19)18-45-27-11-5-24(6-12-27)30(36)33(41)42/h1-15H,16-18H2,(H,37,38)(H,39,40)(H,41,42).
What are the key properties of 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid?
2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid has a molecular weight of 612.54 g/mol, XLogP of 4.23, 15 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[3,5-bis[(4-oxalophenoxy)methyl]phenyl]methoxy]phenyl]-2-oxoacetic acid is sourced from PubChem (CID 10077494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).