C29H20BrN3O8 — CID 10077581
benzhydryl (6S,7S)-3-(bromomethyl)-7-(5-nitro-1,3-dioxoisoindol-2-yl)-8-oxo-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10077581) has the molecular formula C29H20BrN3O8 and a molecular weight of 618.40 g/mol. Its IUPAC name is benzhydryl (6S,7S)-3-(bromomethyl)-7-(5-nitro-1,3-dioxoisoindol-2-yl)-8-oxo-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S,7S)-3-(bromomethyl)-7-(5-nitro-1,3-dioxoisoindol-2-yl)-8-oxo-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10077581 |
| Molecular Formula | C29H20BrN3O8 |
| Molecular Weight | 618.40 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | benzhydryl (6S,7S)-3-(bromomethyl)-7-(5-nitro-1,3-dioxoisoindol-2-yl)-8-oxo-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1=C(CBr)OC[C@@H]2[C@H](N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)C(=O)N12 |
| InChI | InChI=1S/C29H20BrN3O8/c30-14-22-24(29(37)41-25(16-7-3-1-4-8-16)17-9-5-2-6-10-17)31-21(15-40-22)23(28(31)36)32-26(34)19-12-11-18(33(38)39)13-20(19)27(32)35/h1-13,21,23,25H,14-15H2/t21-,23+/m1/s1 |
| InChIKey | FTXPNSUUKUUBIW-GGAORHGYSA-N |
| XLogP | 3.74 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|