C15H24N2O3 — CID 100776447
(2S)-2-ethoxy-N-(6-methoxy-5-methyl-3-pyridinyl)-2-methylpentanamide (PubChem CID 100776447) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S)-2-ethoxy-N-(6-methoxy-5-methyl-3-pyridinyl)-2-methylpentanamide.
| Compound Name | (2S)-2-ethoxy-N-(6-methoxy-5-methyl-3-pyridinyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 100776447 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2S)-2-ethoxy-N-(6-methoxy-5-methyl-3-pyridinyl)-2-methylpentanamide |
| SMILES | CCC[C@](C)(OCC)C(=O)Nc1cnc(OC)c(C)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-6-8-15(4,20-7-2)14(18)17-12-9-11(3)13(19-5)16-10-12/h9-10H,6-8H2,1-5H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | RORYWQOKEZJJCG-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |