C34H59N2O6P — CID 10077648
(2R,4S,5S)-N-butyl-6-cyclohexyl-5-[[(2R)-2-[ethoxy(3-phenylpropyl)phosphoryl]oxyhexanoyl]amino]-4-hydroxy-2-methylhexanamide (PubChem CID 10077648) has the molecular formula C34H59N2O6P and a molecular weight of 622.83 g/mol. Its IUPAC name is (2R,4S,5S)-N-butyl-6-cyclohexyl-5-[[(2R)-2-[ethoxy(3-phenylpropyl)phosphoryl]oxyhexanoyl]amino]-4-hydroxy-2-methylhexanamide.
| Compound Name | (2R,4S,5S)-N-butyl-6-cyclohexyl-5-[[(2R)-2-[ethoxy(3-phenylpropyl)phosphoryl]oxyhexanoyl]amino]-4-hydroxy-2-methylhexanamide |
|---|---|
| PubChem CID | 10077648 |
| Molecular Formula | C34H59N2O6P |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | (2R,4S,5S)-N-butyl-6-cyclohexyl-5-[[(2R)-2-[ethoxy(3-phenylpropyl)phosphoryl]oxyhexanoyl]amino]-4-hydroxy-2-methylhexanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@@H](CCCC)OP(=O)(CCCc1ccccc1)OCC |
| InChI | InChI=1S/C34H59N2O6P/c1-5-8-22-32(42-43(40,41-7-3)24-16-21-28-17-12-10-13-18-28)34(39)36-30(26-29-19-14-11-15-20-29)31(37)25-27(4)33(38)35-23-9-6-2/h10,12-13,17-18,27,29-32,37H,5-9,11,14-16,19-26H2,1-4H3,(H,35,38)(H,36,39)/t27-,30+,31+,32-,43?/m1/s1 |
| InChIKey | SVELIFIDZRDCNX-HXMFWDKASA-N |
| XLogP | 7.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|