C20H18F5NO4 — CID 100779470
N-(4-methoxy-2-methylphenyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxane-5-carboxamide (PubChem CID 100779470) has the molecular formula C20H18F5NO4 and a molecular weight of 431.36 g/mol. Its IUPAC name is N-(4-methoxy-2-methylphenyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxane-5-carboxamide.
| Compound Name | N-(4-methoxy-2-methylphenyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100779470 |
| Molecular Formula | C20H18F5NO4 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-(4-methoxy-2-methylphenyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxane-5-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)COC(c3c(F)c(F)c(F)c(F)c3F)OC2)c(C)c1 |
| InChI | InChI=1S/C20H18F5NO4/c1-9-6-10(28-3)4-5-11(9)26-19(27)20(2)7-29-18(30-8-20)12-13(21)15(23)17(25)16(24)14(12)22/h4-6,18H,7-8H2,1-3H3,(H,26,27) |
| InChIKey | IISPKZGCRYVYHF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|