C35H46FN3O8 — CID 10078060
N-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-6-(5-fluoro-1H-indol-3-yl)hexanamide;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 10078060) has the molecular formula C35H46FN3O8 and a molecular weight of 655.76 g/mol. Its IUPAC name is N-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-6-(5-fluoro-1H-indol-3-yl)hexanamide;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-6-(5-fluoro-1H-indol-3-yl)hexanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 10078060 |
| Molecular Formula | C35H46FN3O8 |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.33 |
| IUPAC Name | N-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-6-(5-fluoro-1H-indol-3-yl)hexanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(CNC(=O)CCCCCc2c[nH]c3ccc(F)cc23)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H38FN3O.C6H8O7/c1-33(2)29(24-10-6-4-7-11-24)17-15-22(16-18-29)20-32-28(34)12-8-3-5-9-23-21-31-27-14-13-25(30)19-26(23)27;7-3(8)1-6(13,5(11)12)2-4(9)10/h4,6-7,10-11,13-14,19,21-22,31H,3,5,8-9,12,15-18,20H2,1-2H3,(H,32,34);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CDSFUIOWGWAZDI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|