C19H21N3O3S — CID 100781224
N-(3-cyanophenyl)-2-[(2,5-dimethylphenyl)sulfonyl-ethylamino]acetamide (PubChem CID 100781224) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(2,5-dimethylphenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(2,5-dimethylphenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 100781224 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(2,5-dimethylphenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(C#N)c1)S(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H21N3O3S/c1-4-22(26(24,25)18-10-14(2)8-9-15(18)3)13-19(23)21-17-7-5-6-16(11-17)12-20/h5-11H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | LZDHLLRRBISGHX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |