C26H27NO2 — CID 100781703
2,2-diphenyl-N-(4-propan-2-yloxyphenyl)pent-4-enamide (PubChem CID 100781703) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-(4-propan-2-yloxyphenyl)pent-4-enamide.
| Compound Name | 2,2-diphenyl-N-(4-propan-2-yloxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 100781703 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2,2-diphenyl-N-(4-propan-2-yloxyphenyl)pent-4-enamide |
| SMILES | C=CCC(C(=O)Nc1ccc(OC(C)C)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-4-19-26(21-11-7-5-8-12-21,22-13-9-6-10-14-22)25(28)27-23-15-17-24(18-16-23)29-20(2)3/h4-18,20H,1,19H2,2-3H3,(H,27,28) |
| InChIKey | UTDAIVOVFXBVEC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|