C29H27NO2 — CID 100781820
N-(4-methoxy-2-methylphenyl)-2,2,3-triphenylpropanamide (PubChem CID 100781820) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(4-methoxy-2-methylphenyl)-2,2,3-triphenylpropanamide.
| Compound Name | N-(4-methoxy-2-methylphenyl)-2,2,3-triphenylpropanamide |
|---|---|
| PubChem CID | 100781820 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(4-methoxy-2-methylphenyl)-2,2,3-triphenylpropanamide |
| SMILES | COc1ccc(NC(=O)C(Cc2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H27NO2/c1-22-20-26(32-2)18-19-27(22)30-28(31)29(24-14-8-4-9-15-24,25-16-10-5-11-17-25)21-23-12-6-3-7-13-23/h3-20H,21H2,1-2H3,(H,30,31) |
| InChIKey | GZTBVILQVFRUSE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |