C20H19ClN2O4S — CID 100782142
(1S,5R)-3-(4-chlorophenyl)-2,2-dioxo-N-(4-prop-2-enoxyphenyl)-2λ6-thia-3-azabicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 100782142) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is (1S,5R)-3-(4-chlorophenyl)-2,2-dioxo-N-(4-prop-2-enoxyphenyl)-2λ6-thia-3-azabicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,5R)-3-(4-chlorophenyl)-2,2-dioxo-N-(4-prop-2-enoxyphenyl)-2λ6-thia-3-azabicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 100782142 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (1S,5R)-3-(4-chlorophenyl)-2,2-dioxo-N-(4-prop-2-enoxyphenyl)-2λ6-thia-3-azabicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)[C@]23C[C@@H]2CN(c2ccc(Cl)cc2)S3(=O)=O)cc1 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-2-11-27-18-9-5-16(6-10-18)22-19(24)20-12-14(20)13-23(28(20,25)26)17-7-3-15(21)4-8-17/h2-10,14H,1,11-13H2,(H,22,24)/t14-,20+/m1/s1 |
| InChIKey | YBLNJGRHFJGOHI-VLIAUNLRSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|