C17H18Cl2N2O3S — CID 100783730
(3R)-N-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)-3-(methanesulfonamido)propanamide (PubChem CID 100783730) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is (3R)-N-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)-3-(methanesulfonamido)propanamide.
| Compound Name | (3R)-N-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 100783730 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (3R)-N-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)-3-(methanesulfonamido)propanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C[C@@H](NS(C)(=O)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-11-9-14(19)7-8-15(11)20-17(22)10-16(21-25(2,23)24)12-3-5-13(18)6-4-12/h3-9,16,21H,10H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | ZCOQBIJHKNBOIO-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |