C42H45NO9 — CID 10078486
(E)-7-[4-[2-[2-[(2S,4S,5R)-5-[(Z)-5-carboxypent-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]phenoxy]ethoxy]phenyl]-7-pyridin-3-ylhept-6-enoic acid (PubChem CID 10078486) has the molecular formula C42H45NO9 and a molecular weight of 707.82 g/mol. Its IUPAC name is (E)-7-[4-[2-[2-[(2S,4S,5R)-5-[(Z)-5-carboxypent-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]phenoxy]ethoxy]phenyl]-7-pyridin-3-ylhept-6-enoic acid.
| Compound Name | (E)-7-[4-[2-[2-[(2S,4S,5R)-5-[(Z)-5-carboxypent-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]phenoxy]ethoxy]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
|---|---|
| PubChem CID | 10078486 |
| Molecular Formula | C42H45NO9 |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.31 |
| IUPAC Name | (E)-7-[4-[2-[2-[(2S,4S,5R)-5-[(Z)-5-carboxypent-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]phenoxy]ethoxy]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2ccccc2OCCOc2ccc(/C(=C\CCCCC(=O)O)c3cccnc3)cc2)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C42H45NO9/c44-37-17-9-7-15-35(37)41-32(12-3-1-5-19-39(45)46)29-51-42(52-41)36-16-8-10-18-38(36)50-27-26-49-33-23-21-30(22-24-33)34(31-13-11-25-43-28-31)14-4-2-6-20-40(47)48/h1,3,7-11,13-18,21-25,28,32,41-42,44H,2,4-6,12,19-20,26-27,29H2,(H,45,46)(H,47,48)/b3-1-,34-14+/t32-,41+,42+/m1/s1 |
| InChIKey | AZDWXPDAJCKMPK-OLQAHIRJSA-N |
| XLogP | 8.54 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|