C14H12Br2Cl6N2O4S2 — CID 10078492
1,6-bis[[(1E,3Z)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl]hexane (PubChem CID 10078492) has the molecular formula C14H12Br2Cl6N2O4S2 and a molecular weight of 708.92 g/mol. Its IUPAC name is 1,6-bis[[(1E,3Z)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl]hexane.
| Compound Name | 1,6-bis[[(1E,3Z)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl]hexane |
|---|---|
| PubChem CID | 10078492 |
| Molecular Formula | C14H12Br2Cl6N2O4S2 |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 703.67 |
| IUPAC Name | 1,6-bis[[(1E,3Z)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl]hexane |
| SMILES | O=[N+]([O-])C(/C(Cl)=C(\Cl)Br)=C(/Cl)SCCCCCCS/C(Cl)=C(C(/Cl)=C(\Cl)Br)\[N+](=O)[O-] |
| InChI | InChI=1S/C14H12Br2Cl6N2O4S2/c15-11(19)7(17)9(23(25)26)13(21)29-5-3-1-2-4-6-30-14(22)10(24(27)28)8(18)12(16)20/h1-6H2/b11-7+,12-8+,13-9-,14-10- |
| InChIKey | ZROXBBTVBYSAGJ-PWBMRHBKSA-N |
| XLogP | 9.47 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|