C14H11N3O4 — CID 100785199
2-(cyanomethyl)-6-(4-methoxyphenyl)-3-oxopyridazine-4-carboxylic acid (PubChem CID 100785199) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-(cyanomethyl)-6-(4-methoxyphenyl)-3-oxopyridazine-4-carboxylic acid.
| Compound Name | 2-(cyanomethyl)-6-(4-methoxyphenyl)-3-oxopyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 100785199 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(cyanomethyl)-6-(4-methoxyphenyl)-3-oxopyridazine-4-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)c(=O)n(CC#N)n2)cc1 |
| InChI | InChI=1S/C14H11N3O4/c1-21-10-4-2-9(3-5-10)12-8-11(14(19)20)13(18)17(16-12)7-6-15/h2-5,8H,7H2,1H3,(H,19,20) |
| InChIKey | IXCOFAABYAZYAS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |