C28H21ClO16S2 — CID 10078531
methyl 4-chloro-4'-hydroxy-7'-methoxy-9',10-bis(methylsulfonyloxy)-5',8',9-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate (PubChem CID 10078531) has the molecular formula C28H21ClO16S2 and a molecular weight of 713.05 g/mol. Its IUPAC name is methyl 4-chloro-4'-hydroxy-7'-methoxy-9',10-bis(methylsulfonyloxy)-5',8',9-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate.
| Compound Name | methyl 4-chloro-4'-hydroxy-7'-methoxy-9',10-bis(methylsulfonyloxy)-5',8',9-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
|---|---|
| PubChem CID | 10078531 |
| Molecular Formula | C28H21ClO16S2 |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 712.00 |
| IUPAC Name | methyl 4-chloro-4'-hydroxy-7'-methoxy-9',10-bis(methylsulfonyloxy)-5',8',9-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
| SMILES | COC(=O)c1cc2cc3c(c(OS(C)(=O)=O)c2c(=O)o1)OC1(Cc2c(O)c4c(c(OS(C)(=O)=O)c2O1)C(=O)C(OC)=CC4=O)CC3Cl |
| InChI | InChI=1S/C28H21ClO16S2/c1-39-15-7-14(30)18-19(21(15)32)25(45-47(4,37)38)23-12(20(18)31)8-28(43-23)9-13(29)11-5-10-6-16(26(33)40-2)41-27(34)17(10)24(22(11)42-28)44-46(3,35)36/h5-7,13,31H,8-9H2,1-4H3 |
| InChIKey | XGCUOOFLNQKCJC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 225.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|