C25H25N3O5S — CID 100785320
4-(ethylsulfonylamino)-N-[1-(4-methoxybenzoyl)-2,3-dihydroindol-6-yl]benzamide (PubChem CID 100785320) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-N-[1-(4-methoxybenzoyl)-2,3-dihydroindol-6-yl]benzamide.
| Compound Name | 4-(ethylsulfonylamino)-N-[1-(4-methoxybenzoyl)-2,3-dihydroindol-6-yl]benzamide |
|---|---|
| PubChem CID | 100785320 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-(ethylsulfonylamino)-N-[1-(4-methoxybenzoyl)-2,3-dihydroindol-6-yl]benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)Nc2ccc3c(c2)N(C(=O)c2ccc(OC)cc2)CC3)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-3-34(31,32)27-20-9-5-18(6-10-20)24(29)26-21-11-4-17-14-15-28(23(17)16-21)25(30)19-7-12-22(33-2)13-8-19/h4-13,16,27H,3,14-15H2,1-2H3,(H,26,29) |
| InChIKey | TUIBTBLDQHMGLC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |