C14H14N2O3S — CID 100785362
ethyl 3-oxo-2-prop-2-enyl-6-thiophen-2-ylpyridazine-4-carboxylate (PubChem CID 100785362) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is ethyl 3-oxo-2-prop-2-enyl-6-thiophen-2-ylpyridazine-4-carboxylate.
| Compound Name | ethyl 3-oxo-2-prop-2-enyl-6-thiophen-2-ylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 100785362 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | ethyl 3-oxo-2-prop-2-enyl-6-thiophen-2-ylpyridazine-4-carboxylate |
| SMILES | C=CCn1nc(-c2cccs2)cc(C(=O)OCC)c1=O |
| InChI | InChI=1S/C14H14N2O3S/c1-3-7-16-13(17)10(14(18)19-4-2)9-11(15-16)12-6-5-8-20-12/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | ALSCTJGBRUSVTD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|