C9H9N5O3 — CID 100786248
3-[(3-nitrophenyl)methoxy]-1H-1,2,4-triazol-5-amine (PubChem CID 100786248) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-[(3-nitrophenyl)methoxy]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[(3-nitrophenyl)methoxy]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 100786248 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-[(3-nitrophenyl)methoxy]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(OCc2cccc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C9H9N5O3/c10-8-11-9(13-12-8)17-5-6-2-1-3-7(4-6)14(15)16/h1-4H,5H2,(H3,10,11,12,13) |
| InChIKey | YUJCNRFLGTWJRZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|