C18H21NO3 — CID 100789389
3-(2,6-dimethoxyphenyl)-N-(4-methylphenyl)propanamide (PubChem CID 100789389) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-N-(4-methylphenyl)propanamide.
| Compound Name | 3-(2,6-dimethoxyphenyl)-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100789389 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-N-(4-methylphenyl)propanamide |
| SMILES | COc1cccc(OC)c1CCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-13-7-9-14(10-8-13)19-18(20)12-11-15-16(21-2)5-4-6-17(15)22-3/h4-10H,11-12H2,1-3H3,(H,19,20) |
| InChIKey | MNFCNRIZDULCBY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |