C25H28ClN3O5S2 — CID 100790408
2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100790408) has the molecular formula C25H28ClN3O5S2 and a molecular weight of 550.10 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100790408 |
| Molecular Formula | C25H28ClN3O5S2 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H28ClN3O5S2/c1-20-7-11-23(12-8-20)35(31,32)28-17-16-27-25(30)19-29(18-15-21-5-3-2-4-6-21)36(33,34)24-13-9-22(26)10-14-24/h2-14,28H,15-19H2,1H3,(H,27,30) |
| InChIKey | FOYNDYGOVFRHMB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|