methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate

C11H17NO2 — CID 100792585

IUPACmethyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate
SMILESCCc1ccc(C(=O)OC)n1C(C)C
InChIInChI=1S/C11H17NO2/c1-5-9-6-7-10(11(13)14-4)12(9)8(2)3/h6-8H,5H2,1-4H3
InChIKeyUOVUGZXICAUBKK-UHFFFAOYSA-N
MW195.26 g/mol
LogP2.42
Rot. Bonds3

About methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate

methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate (PubChem CID 100792585) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate
PubChem CID100792585
Molecular FormulaC11H17NO2
Molecular Weight195.26 g/mol
Exact Mass195.13
IUPAC Namemethyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate
SMILESCCc1ccc(C(=O)OC)n1C(C)C
InChIInChI=1S/C11H17NO2/c1-5-9-6-7-10(11(13)14-4)12(9)8(2)3/h6-8H,5H2,1-4H3
InChIKeyUOVUGZXICAUBKK-UHFFFAOYSA-N
XLogP2.42
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.26
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate?
The IUPAC name of methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate (CID 100792585) is methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate?
The canonical SMILES for methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate is CCc1ccc(C(=O)OC)n1C(C)C.
What is the InChIKey of methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate?
The InChIKey is UOVUGZXICAUBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-5-9-6-7-10(11(13)14-4)12(9)8(2)3/h6-8H,5H2,1-4H3.
What are the key properties of methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate?
methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate has a molecular weight of 195.26 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-1-propan-2-ylpyrrole-2-carboxylate is sourced from PubChem (CID 100792585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).