C12H19NO2 — CID 100793036
1-(2-methylpropyl)-5-propylpyrrole-2-carboxylic acid (PubChem CID 100793036) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5-propylpyrrole-2-carboxylic acid.
| Compound Name | 1-(2-methylpropyl)-5-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 100793036 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(2-methylpropyl)-5-propylpyrrole-2-carboxylic acid |
| SMILES | CCCc1ccc(C(=O)O)n1CC(C)C |
| InChI | InChI=1S/C12H19NO2/c1-4-5-10-6-7-11(12(14)15)13(10)8-9(2)3/h6-7,9H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | MTHWONSEUQHVJX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |