C25H33N3O6S2 — CID 100795466
4-methoxy-3-piperidin-1-ylsulfonyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzamide (PubChem CID 100795466) has the molecular formula C25H33N3O6S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-methoxy-3-piperidin-1-ylsulfonyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 4-methoxy-3-piperidin-1-ylsulfonyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 100795466 |
| Molecular Formula | C25H33N3O6S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-methoxy-3-piperidin-1-ylsulfonyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H33N3O6S2/c1-34-23-12-9-21(19-24(23)36(32,33)28-15-3-2-4-16-28)25(29)26-14-13-20-7-10-22(11-8-20)35(30,31)27-17-5-6-18-27/h7-12,19H,2-6,13-18H2,1H3,(H,26,29) |
| InChIKey | MZKVDQHZPIELSP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |