C17H16ClN3O3S2 — CID 100795907
N-(1,2-benzothiazol-5-yl)-2-[(4-chlorophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 100795907) has the molecular formula C17H16ClN3O3S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is N-(1,2-benzothiazol-5-yl)-2-[(4-chlorophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-(1,2-benzothiazol-5-yl)-2-[(4-chlorophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 100795907 |
| Molecular Formula | C17H16ClN3O3S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-(1,2-benzothiazol-5-yl)-2-[(4-chlorophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc2sncc2c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O3S2/c1-2-21(26(23,24)15-6-3-13(18)4-7-15)11-17(22)20-14-5-8-16-12(9-14)10-19-25-16/h3-10H,2,11H2,1H3,(H,20,22) |
| InChIKey | WFADDHPBKPKEBD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |