C24H32ClN3O6S2 — CID 100796300
2-[(3-chloro-4-methoxyphenyl)sulfonyl-cyclohexylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100796300) has the molecular formula C24H32ClN3O6S2 and a molecular weight of 558.12 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonyl-cyclohexylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-cyclohexylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100796300 |
| Molecular Formula | C24H32ClN3O6S2 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-cyclohexylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCNS(=O)(=O)c2ccc(C)cc2)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C24H32ClN3O6S2/c1-18-8-10-20(11-9-18)35(30,31)27-15-14-26-24(29)17-28(19-6-4-3-5-7-19)36(32,33)21-12-13-23(34-2)22(25)16-21/h8-13,16,19,27H,3-7,14-15,17H2,1-2H3,(H,26,29) |
| InChIKey | BZTWGAKUQASCRQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|