C19H20ClN3O4S — CID 100797095
2-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 100797095) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100797095 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(CC#N)cc1)S(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-3-23(28(25,26)16-8-9-18(27-2)17(20)12-16)13-19(24)22-15-6-4-14(5-7-15)10-11-21/h4-9,12H,3,10,13H2,1-2H3,(H,22,24) |
| InChIKey | JJNIARBLDJSNKR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |