C25H31N3O2 — CID 100799008
(4R)-2-amino-7,7-dimethyl-5-oxo-4-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 100799008) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4R)-2-amino-7,7-dimethyl-5-oxo-4-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-7,7-dimethyl-5-oxo-4-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 100799008 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (4R)-2-amino-7,7-dimethyl-5-oxo-4-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2ccc([C@@H]3C(C#N)=C(N)OC4=C3C(=O)CC(C)(C)C4)cc21 |
| InChI | InChI=1S/C25H31N3O2/c1-14-10-25(4,5)28(6)18-8-7-15(9-16(14)18)21-17(13-26)23(27)30-20-12-24(2,3)11-19(29)22(20)21/h7-9,14,21H,10-12,27H2,1-6H3/t14-,21-/m1/s1 |
| InChIKey | OITUOTRRXAYPNP-SPLOXXLWSA-N |
| XLogP | 4.86 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |