C19H27NO5S — CID 100799403
ethyl (2S,3aS,4S,8aS)-4-hydroxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate (PubChem CID 100799403) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is ethyl (2S,3aS,4S,8aS)-4-hydroxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3aS,4S,8aS)-4-hydroxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 100799403 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl (2S,3aS,4S,8aS)-4-hydroxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2[C@@H](O)CCCC[C@@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-3-25-19(22)17-12-15-16(6-4-5-7-18(15)21)20(17)26(23,24)14-10-8-13(2)9-11-14/h8-11,15-18,21H,3-7,12H2,1-2H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | WOEOFAYTCJKTCD-XSLAGTTESA-N |
| XLogP | 2.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |