C14H12ClN5O — CID 100802493
2-(2-chlorophenyl)-7-methylpyrazolo[1,5-a]pyrimidine-6-carbohydrazide (PubChem CID 100802493) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-7-methylpyrazolo[1,5-a]pyrimidine-6-carbohydrazide.
| Compound Name | 2-(2-chlorophenyl)-7-methylpyrazolo[1,5-a]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 100802493 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(2-chlorophenyl)-7-methylpyrazolo[1,5-a]pyrimidine-6-carbohydrazide |
| SMILES | Cc1c(C(=O)NN)cnc2cc(-c3ccccc3Cl)nn12 |
| InChI | InChI=1S/C14H12ClN5O/c1-8-10(14(21)18-16)7-17-13-6-12(19-20(8)13)9-4-2-3-5-11(9)15/h2-7H,16H2,1H3,(H,18,21) |
| InChIKey | XXKPXCGWTCHLKI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|