About 1-methoxybutan-2-one
1-methoxybutan-2-one (PubChem CID 10080345) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is 1-methoxybutan-2-one.
Molecular Properties
| Compound Name | 1-methoxybutan-2-one |
| PubChem CID | 10080345 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | 1-methoxybutan-2-one |
| SMILES | CCC(=O)COC |
| InChI | InChI=1S/C5H10O2/c1-3-5(6)4-7-2/h3-4H2,1-2H3 |
| InChIKey | AKXHGJCMQJQWMU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxybutan-2-one?
The IUPAC name of 1-methoxybutan-2-one (CID 10080345) is 1-methoxybutan-2-one.
What is the SMILES notation for 1-methoxybutan-2-one?
The canonical SMILES for 1-methoxybutan-2-one is CCC(=O)COC.
What is the InChIKey of 1-methoxybutan-2-one?
The InChIKey is AKXHGJCMQJQWMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2/c1-3-5(6)4-7-2/h3-4H2,1-2H3.
What are the key properties of 1-methoxybutan-2-one?
1-methoxybutan-2-one has a molecular weight of 102.13 g/mol, XLogP of 0.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxybutan-2-one is sourced from PubChem (CID 10080345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).